Skip to content

Complex Analysis Review

Everything from the section, arranged for lookup: the definitions, the named theorems, the standard maps, the contour recipes, and the notation. Use it as a reference rather than reading straight through.

Arithmetic in polar form is the working skill:

z1z2=r1r2ei(θ1+θ2),zn=rneinθz_1z_2 = r_1r_2e^{i(\theta_1+\theta_2)}, \qquad z^n = r^ne^{in\theta}

Multiply the moduli, add the arguments. Multiplication by ii is a quarter turn.

  • z1z2=z1z2|z_1z_2| = |z_1||z_2|, but z1+z2|z_1+z_2| has no formula, only the triangle inequality.
  • zzˉ=z2z\bar z = |z|^2, which is how division is done.
  • zn=wz^n = w has exactly nn solutions, forming a regular nn-gon.
  • The nnth roots of unity sum to 0 and form a cyclic group of order nn.

Set descriptions: za=r|z-a|=r is a circle, za<r|z-a|<r a disc, r1<za<r2r_1<|z-a|<r_2 an annulus, α<Argz<β\alpha<\operatorname{Arg}z<\beta a sector.

Complex differentiability requires the difference quotient’s limit to be the same from every direction. That forces the Cauchy–Riemann equations, and geometrically it forces the map to be locally a rotation and a uniform scaling.

Fails everywhere: zˉ\bar z, z|z|, Rez\operatorname{Re}z, Imz\operatorname{Im}z. Fails except at one point, hence analytic nowhere: z2|z|^2.

Analytic means differentiable on an open set, not at a point. Everything below needs the open set.

  • Infinite differentiability, and each derivative analytic
  • Equality with the Taylor series on any disc in the domain
  • The identity theorem: agreement on a set with a limit point forces global agreement
  • The maximum modulus principle: no interior maximum of f|f|
  • Liouville: bounded plus entire implies constant
  • Open mapping, and conformality where f0f'\ne0
  • uu and vv harmonic, with orthogonal level curves
ez=ex(cosy+isiny),ez+2πi=ez,ez0e^z = e^x(\cos y+i\sin y), \qquad e^{z+2\pi i}=e^z, \qquad e^z \ne 0

Periodicity is the source of everything awkward. It makes log\log multi-valued:

logz=lnz+i(Argz+2πk),Log(1)=iπ\log z = \ln|z|+i(\operatorname{Arg}z+2\pi k), \qquad \operatorname{Log}(-1)=i\pi

which needs a branch cut, conventionally the negative real axis. Log(z1z2)=Logz1+Logz2\operatorname{Log}(z_1z_2) = \operatorname{Log}z_1+\operatorname{Log}z_2 can fail by 2πi2\pi i.

sinz\sin z and cosz\cos z are entire and unbounded, since sin(iy)=isinhy\sin(iy)=i\sinh y; Liouville requires it. Their zeros stay real. Powers za=ealogzz^a = e^{a\log z} give one value for integer aa, qq values for a=p/qa=p/q, and infinitely many otherwise; ii=eπ/22πki^i = e^{-\pi/2-2\pi k} is always real.

γfdz=abf(γ(t))γ(t)dt\int_\gamma f\,dz = \int_a^b f(\gamma(t))\gamma'(t)\,dt

The one computation to memorize:

z=1dzz=2πi,z=1zndz=0 (n1)\oint_{|z|=1}\frac{dz}{z} = 2\pi i, \qquad \oint_{|z|=1}z^n\,dz = 0 \ (n\ne-1)

The exponent 1-1 being the sole exception is why residues exist.

ML inequality: γfML\left|\int_\gamma f\right|\le ML. Used to kill large arcs.

TheoremStatement
Cauchy’s theoremff analytic on a simply connected domain Cf=0\Rightarrow \oint_C f = 0
DeformationReshaping a contour changes nothing unless it crosses a singularity
Multiply connectedAn outer contour equals the sum of contours around the holes
Integral formulaf(z0)=12πiCf(z)zz0dzf(z_0) = \frac{1}{2\pi i}\oint_C\frac{f(z)}{z-z_0}dz
Derivative formulaf(n)(z0)=n!2πiCf(z)(zz0)n+1dzf^{(n)}(z_0) = \frac{n!}{2\pi i}\oint_C\frac{f(z)}{(z-z_0)^{n+1}}dz
Mean value propertyf(z0)f(z_0) is the average of ff over any circle about it
MoreraVanishing closed integrals plus continuity implies analytic

Cauchy’s theorem is the Cauchy–Riemann equations integrated, via Green’s theorem. The integral formula is where infinite differentiability comes from, and it gives Liouville, then the fundamental theorem of algebra, in a few lines each.

Taylor. Analytic on a disc means equal to the Taylor series there. Over C\mathbb{C}, analytic and locally a power series coincide, unlike over R\mathbb{R}.

R=distance from the centre to the nearest singularityR = \text{distance from the centre to the nearest singularity}

Laurent. On an annulus r<zz0<Rr<|z-z_0|<R,

f(z)=n=cn(zz0)nf(z) = \sum_{n=-\infty}^{\infty}c_n(z-z_0)^n

unique for that annulus. One function can have several Laurent series about the same centre, one per annulus of analyticity. Compute them with partial fractions plus geometric series, deciding which factor to pull out by which ratio has modulus below 1.

The consequence that matters:

Cfdz=2πic1\oint_C f\,dz = 2\pi i\,c_{-1}
TypeLimit behaviourPrincipal part
Removablelimf\lim f exists (boundedness suffices)empty
Pole of order mmf\lvert f\rvert\to\inftymm terms
Essentialno limit at allinfinite

For f=p/qf=p/q with zero orders aa and bb: removable if aba\ge b, pole of order bab-a if a<ba<b. Cancel before classifying.

Near an essential singularity, Casorati–Weierstrass gives a dense image and Picard gives every value infinitely often with at most one exception.

Residue formulas:

simple: limzz0(zz0)f(z),p(z0)q(z0)\text{simple: } \lim_{z\to z_0}(z-z_0)f(z), \qquad \frac{p(z_0)}{q'(z_0)} order m: 1(m1)!limzz0dm1dzm1[(zz0)mf(z)]\text{order } m: \ \frac{1}{(m-1)!}\lim_{z\to z_0}\frac{d^{m-1}}{dz^{m-1}}\big[(z-z_0)^mf(z)\big]

Essential singularities have no formula; expand the series.

Residue theorem: Cf=2πiRes\oint_C f = 2\pi i\sum\operatorname{Res} over enclosed singularities only.

IntegralContourExtra tool
pq\int_{-\infty}^\infty \frac{p}{q}, degqdegp+2\deg q\ge\deg p+2upper semicircleML on the arc
f(x)eiaxdx\int_{-\infty}^\infty f(x)e^{iax}dx, a>0a>0upper semicircleJordan’s lemma
02πR(cosθ,sinθ)dθ\int_0^{2\pi}R(\cos\theta,\sin\theta)d\thetaunit circle, z=eiθz=e^{i\theta}dθ=dz/(iz)d\theta = dz/(iz)
0\int_0^\infty with xnx^n symmetrysector of angle 2π/n2\pi/nmatch the symmetry
0xa1f(x)dx\int_0^\infty x^{a-1}f(x)dxkeyholethe branch jump
pole on the real axisindented contourhalf-loop gives πiRes\pi i\operatorname{Res}

Reference values: dx1+x2=π\int\frac{dx}{1+x^2}=\pi, dx1+x4=π2\int\frac{dx}{1+x^4}=\frac{\pi}{\sqrt2}, cosx1+x2dx=πe\int\frac{\cos x}{1+x^2}dx=\frac{\pi}{e}, 0sinxxdx=π2\int_0^\infty\frac{\sin x}{x}dx=\frac{\pi}{2}.

Conformal means angle-preserving, and an analytic ff is conformal exactly where f0f'\ne0. At a zero of order mm in ff', angles are multiplied by m+1m+1.

Möbius maps az+bcz+d\frac{az+b}{cz+d} with adbc0ad-bc\ne0 are bijections of C^\hat{\mathbb{C}}, form a group, send circles and lines to circles and lines, and are determined by three points.

MapEffect
az+baz+bsimilarity
1/z1/zinversion
ziz+i\frac{z-i}{z+i}upper half plane \to disc
z2z^2quarter plane \to half plane
eze^zstrip of height π\pi \to half plane
z+1zz+\frac1zcircle \to segment (Joukowski)

Riemann mapping theorem: every simply connected domain other than C\mathbb{C} maps conformally onto the disc. Existence only, no formula.

Argument principle: 12πiff=ZP\frac{1}{2\pi i}\oint\frac{f'}{f} = Z-P, equal to the winding number of the image around 0.

Rouché: g<f|g|<|f| on CC implies ff and f+gf+g have the same zero count inside. Gives the fundamental theorem of algebra with the exact count.

2u=0\nabla^2u=0. The real and imaginary parts of an analytic function are harmonic, and on a simply connected domain every harmonic function has a harmonic conjugate, unique up to a constant. On an annulus lnz\ln|z| shows the conjugate can fail to exist globally.

Inherited properties: mean value, maximum principle, uniqueness from boundary data, infinite smoothness, Liouville.

The Dirichlet problem is solved on the disc by the Poisson integral formula and elsewhere by conformal mapping. Level curves of uu and vv are the equipotentials and field lines, or isotherms and heat flow, or velocity potential and streamlines.

TheoremStatement
Cauchy–Riemannux=vyu_x=v_y and uy=vxu_y=-v_x characterize differentiability
Cauchy’s theoremCf=0\oint_C f = 0 on a simply connected domain
Cauchy’s integral formulaBoundary values determine interior values
MoreraConverse of Cauchy’s theorem
LiouvilleBounded plus entire implies constant
Fundamental theorem of algebraEvery non-constant polynomial has a root
Maximum modulusNo interior maximum of f\lvert f\rvert
Identity theoremAgreement on a set with a limit point forces global agreement
TaylorAnalytic on a disc means equal to the power series
LaurentAnalytic on an annulus means a two-sided series
Riemann (removable)Bounded near a singularity implies removable
Casorati–WeierstrassDense image near an essential singularity
PicardEvery value, infinitely often, at most one exception
Residue theoremCf=2πiRes\oint_C f = 2\pi i\sum\operatorname{Res}
Argument principle12πiff=ZP\frac{1}{2\pi i}\oint\frac{f'}{f}=Z-P
Rouchég<f\lvert g\rvert<\lvert f\rvert preserves the zero count
Riemann mappingSimply connected, not C\mathbb{C}, maps onto the disc
Jordan’s lemmaOscillatory arcs vanish with only f0f\to0
  • Forgetting simple connectivity in Cauchy’s theorem. dzz=2πi\oint\frac{dz}{z}=2\pi i is the standing counterexample.
  • Confusing arg\arg with Arg\operatorname{Arg}, or ignoring the quadrant when computing an argument.
  • Applying Log(z1z2)=Logz1+Logz2\operatorname{Log}(z_1z_2)=\operatorname{Log}z_1+\operatorname{Log}z_2 to principal values.
  • Assuming sinz1\lvert\sin z\rvert\le1. True on R\mathbb{R} only.
  • Saying “differentiable at a point” when analyticity is needed. z2\lvert z\rvert^2 is the reminder.
  • Not cancelling before classifying a singularity. sinzz3\frac{\sin z}{z^3} has a pole of order 2, not 3.
  • Assuming residue and order are linked. A high-order pole can have residue 0.
  • Including residues of poles outside the contour.
  • Reading a Laurent series as belonging to a function alone. It belongs to a function and an annulus.
  • Forgetting to check the arc vanishes before equating a real integral with 2πiRes2\pi i\sum\operatorname{Res}.
  • Using a conformal map through a critical point, where f=0f'=0 and angles are not preserved.
  • Expecting a harmonic conjugate on a region with a hole.
What makes complex differentiability much stronger than real differentiability?
What is (1 + i)^8 in polar form?
Where is f(z) = |z|² differentiable, and where is it analytic?
What is Log(−i)?
Why is ∮_{|z|=1} dz/z equal to 2πi rather than 0?
What is ∮_{|z|=2} e^z/(z − 1) dz?
Why does e^z fail to be injective on ℂ?
What is the radius of convergence of the Taylor series of 1/(z² + 9) about 0?
How many Laurent series does 1/((z − 1)(z − 3)) have about 0?
What kind of singularity does sin z / z⁴ have at 0?
What is the residue of 1/(z² + 1) at z = i?
What is ∫_{−∞}^{∞} dx/(1 + x⁴)?
What does Jordan's lemma add to the ML inequality?
Where is an analytic function conformal?
What is the key property of Möbius transformations?
How many zeros does z⁵ + 3z + 1 have in |z| < 1?
What does the argument principle count?
Which function is harmonic?
For a continuous-time system, what does a pole at s = −2 + 3i produce?
Why can a bounded entire function only be constant?